C14H21ClN4O — CID 114446204
4-[(4-aminocyclohexyl)amino]-5-chloro-2-(cyclopropylmethyl)pyridazin-3-one (PubChem CID 114446204) has the molecular formula C14H21ClN4O and a molecular weight of 296.80 g/mol. Its IUPAC name is 4-[(4-aminocyclohexyl)amino]-5-chloro-2-(cyclopropylmethyl)pyridazin-3-one.
| Compound Name | 4-[(4-aminocyclohexyl)amino]-5-chloro-2-(cyclopropylmethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 114446204 |
| Molecular Formula | C14H21ClN4O |
| Molecular Weight | 296.80 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 4-[(4-aminocyclohexyl)amino]-5-chloro-2-(cyclopropylmethyl)pyridazin-3-one |
| SMILES | NC1CCC(Nc2c(Cl)cnn(CC3CC3)c2=O)CC1 |
| InChI | InChI=1S/C14H21ClN4O/c15-12-7-17-19(8-9-1-2-9)14(20)13(12)18-11-5-3-10(16)4-6-11/h7,9-11,18H,1-6,8,16H2 |
| InChIKey | UYTWZEALVJXBLM-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.80 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |