C14H17N5O2 — CID 102739177
N-[(1R,2R)-2-hydroxycyclohexyl]-3-(2H-tetrazol-5-yl)benzamide (PubChem CID 102739177) has the molecular formula C14H17N5O2 and a molecular weight of 287.32 g/mol. Its IUPAC name is N-[(1R,2R)-2-hydroxycyclohexyl]-3-(2H-tetrazol-5-yl)benzamide.
| Compound Name | N-[(1R,2R)-2-hydroxycyclohexyl]-3-(2H-tetrazol-5-yl)benzamide |
|---|---|
| PubChem CID | 102739177 |
| Molecular Formula | C14H17N5O2 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | N-[(1R,2R)-2-hydroxycyclohexyl]-3-(2H-tetrazol-5-yl)benzamide |
| SMILES | O=C(N[C@@H]1CCCC[C@H]1O)c1cccc(-c2nn[nH]n2)c1 |
| InChI | InChI=1S/C14H17N5O2/c20-12-7-2-1-6-11(12)15-14(21)10-5-3-4-9(8-10)13-16-18-19-17-13/h3-5,8,11-12,20H,1-2,6-7H2,(H,15,21)(H,16,17,18,19)/t11-,12-/m1/s1 |
| InChIKey | IRMZGDBLDUQUHU-VXGBXAGGSA-N |
| XLogP | 0.90 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |