C17H28N2O2 — CID 102742855
2-propan-2-yloxy-6-(2,2,6,6-tetramethylmorpholin-4-yl)aniline (PubChem CID 102742855) has the molecular formula C17H28N2O2 and a molecular weight of 292.42 g/mol. Its IUPAC name is 2-propan-2-yloxy-6-(2,2,6,6-tetramethylmorpholin-4-yl)aniline.
| Compound Name | 2-propan-2-yloxy-6-(2,2,6,6-tetramethylmorpholin-4-yl)aniline |
|---|---|
| PubChem CID | 102742855 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | 2-propan-2-yloxy-6-(2,2,6,6-tetramethylmorpholin-4-yl)aniline |
| SMILES | CC(C)Oc1cccc(N2CC(C)(C)OC(C)(C)C2)c1N |
| InChI | InChI=1S/C17H28N2O2/c1-12(2)20-14-9-7-8-13(15(14)18)19-10-16(3,4)21-17(5,6)11-19/h7-9,12H,10-11,18H2,1-6H3 |
| InChIKey | MFUIWBQUATXQSF-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|