C15H20N2O3S — CID 102743888
4-(2,2,6,6-tetramethylmorpholin-4-yl)sulfonylbenzonitrile (PubChem CID 102743888) has the molecular formula C15H20N2O3S and a molecular weight of 308.40 g/mol. Its IUPAC name is 4-(2,2,6,6-tetramethylmorpholin-4-yl)sulfonylbenzonitrile.
| Compound Name | 4-(2,2,6,6-tetramethylmorpholin-4-yl)sulfonylbenzonitrile |
|---|---|
| PubChem CID | 102743888 |
| Molecular Formula | C15H20N2O3S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 4-(2,2,6,6-tetramethylmorpholin-4-yl)sulfonylbenzonitrile |
| SMILES | CC1(C)CN(S(=O)(=O)c2ccc(C#N)cc2)CC(C)(C)O1 |
| InChI | InChI=1S/C15H20N2O3S/c1-14(2)10-17(11-15(3,4)20-14)21(18,19)13-7-5-12(9-16)6-8-13/h5-8H,10-11H2,1-4H3 |
| InChIKey | APPBASZSFMNYEG-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |