C9H20N4O — CID 102744295
N'-amino-2,2,6,6-tetramethylmorpholine-4-carboximidamide (PubChem CID 102744295) has the molecular formula C9H20N4O and a molecular weight of 200.29 g/mol. Its IUPAC name is N'-amino-2,2,6,6-tetramethylmorpholine-4-carboximidamide.
| Compound Name | N'-amino-2,2,6,6-tetramethylmorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 102744295 |
| Molecular Formula | C9H20N4O |
| Molecular Weight | 200.29 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | N'-amino-2,2,6,6-tetramethylmorpholine-4-carboximidamide |
| SMILES | CC1(C)CN(C(N)=NN)CC(C)(C)O1 |
| InChI | InChI=1S/C9H20N4O/c1-8(2)5-13(7(10)12-11)6-9(3,4)14-8/h5-6,11H2,1-4H3,(H2,10,12) |
| InChIKey | DZNKLXBJDCGMCP-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 76.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.29 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|