C13H26N2O — CID 102746291
2,2-dimethyl-1-(2,2,6,6-tetramethylmorpholin-4-yl)propan-1-imine (PubChem CID 102746291) has the molecular formula C13H26N2O and a molecular weight of 226.36 g/mol. Its IUPAC name is 2,2-dimethyl-1-(2,2,6,6-tetramethylmorpholin-4-yl)propan-1-imine.
| Compound Name | 2,2-dimethyl-1-(2,2,6,6-tetramethylmorpholin-4-yl)propan-1-imine |
|---|---|
| PubChem CID | 102746291 |
| Molecular Formula | C13H26N2O |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.20 |
| IUPAC Name | 2,2-dimethyl-1-(2,2,6,6-tetramethylmorpholin-4-yl)propan-1-imine |
| SMILES | [H]/N=C(/N1CC(C)(C)OC(C)(C)C1)C(C)(C)C |
| InChI | InChI=1S/C13H26N2O/c1-11(2,3)10(14)15-8-12(4,5)16-13(6,7)9-15/h14H,8-9H2,1-7H3/b14-10+ |
| InChIKey | OQEYGQRDRXKSEZ-GXDHUFHOSA-N |
| XLogP | 2.90 |
| TPSA | 36.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|