C15H29NOS — CID 102746571
[1-[(2,2,6,6-tetramethylmorpholin-4-yl)methyl]cyclopentyl]methanethiol (PubChem CID 102746571) has the molecular formula C15H29NOS and a molecular weight of 271.47 g/mol. Its IUPAC name is [1-[(2,2,6,6-tetramethylmorpholin-4-yl)methyl]cyclopentyl]methanethiol.
| Compound Name | [1-[(2,2,6,6-tetramethylmorpholin-4-yl)methyl]cyclopentyl]methanethiol |
|---|---|
| PubChem CID | 102746571 |
| Molecular Formula | C15H29NOS |
| Molecular Weight | 271.47 g/mol |
| Exact Mass | 271.20 |
| IUPAC Name | [1-[(2,2,6,6-tetramethylmorpholin-4-yl)methyl]cyclopentyl]methanethiol |
| SMILES | CC1(C)CN(CC2(CS)CCCC2)CC(C)(C)O1 |
| InChI | InChI=1S/C15H29NOS/c1-13(2)9-16(10-14(3,4)17-13)11-15(12-18)7-5-6-8-15/h18H,5-12H2,1-4H3 |
| InChIKey | KXEGLOLKTREARF-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 12.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.47 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|