C13H25NO2S2 — CID 114083834
[1-[(1,1-dioxo-1,4-thiazepan-4-yl)methyl]cyclohexyl]methanethiol (PubChem CID 114083834) has the molecular formula C13H25NO2S2 and a molecular weight of 291.48 g/mol. Its IUPAC name is [1-[(1,1-dioxo-1,4-thiazepan-4-yl)methyl]cyclohexyl]methanethiol.
| Compound Name | [1-[(1,1-dioxo-1,4-thiazepan-4-yl)methyl]cyclohexyl]methanethiol |
|---|---|
| PubChem CID | 114083834 |
| Molecular Formula | C13H25NO2S2 |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | [1-[(1,1-dioxo-1,4-thiazepan-4-yl)methyl]cyclohexyl]methanethiol |
| SMILES | O=S1(=O)CCCN(CC2(CS)CCCCC2)CC1 |
| InChI | InChI=1S/C13H25NO2S2/c15-18(16)9-4-7-14(8-10-18)11-13(12-17)5-2-1-3-6-13/h17H,1-12H2 |
| InChIKey | VFJJMEKEJAMCKF-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 37.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|