C12H23NO2S — CID 106674387
1-[[1-(sulfanylmethyl)cyclohexyl]methyl]pyrrolidine-3,4-diol (PubChem CID 106674387) has the molecular formula C12H23NO2S and a molecular weight of 245.39 g/mol. Its IUPAC name is 1-[[1-(sulfanylmethyl)cyclohexyl]methyl]pyrrolidine-3,4-diol.
| Compound Name | 1-[[1-(sulfanylmethyl)cyclohexyl]methyl]pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 106674387 |
| Molecular Formula | C12H23NO2S |
| Molecular Weight | 245.39 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 1-[[1-(sulfanylmethyl)cyclohexyl]methyl]pyrrolidine-3,4-diol |
| SMILES | OC1CN(CC2(CS)CCCCC2)CC1O |
| InChI | InChI=1S/C12H23NO2S/c14-10-6-13(7-11(10)15)8-12(9-16)4-2-1-3-5-12/h10-11,14-16H,1-9H2 |
| InChIKey | QGJFTYQQARSTJX-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.39 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|