C14H30N4O2 — CID 102746791
N-amino-N'-(3-ethoxypropyl)-2,2,6,6-tetramethylmorpholine-4-carboximidamide (PubChem CID 102746791) has the molecular formula C14H30N4O2 and a molecular weight of 286.42 g/mol. Its IUPAC name is N-amino-N'-(3-ethoxypropyl)-2,2,6,6-tetramethylmorpholine-4-carboximidamide.
| Compound Name | N-amino-N'-(3-ethoxypropyl)-2,2,6,6-tetramethylmorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 102746791 |
| Molecular Formula | C14H30N4O2 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.24 |
| IUPAC Name | N-amino-N'-(3-ethoxypropyl)-2,2,6,6-tetramethylmorpholine-4-carboximidamide |
| SMILES | CCOCCC/N=C(\NN)N1CC(C)(C)OC(C)(C)C1 |
| InChI | InChI=1S/C14H30N4O2/c1-6-19-9-7-8-16-12(17-15)18-10-13(2,3)20-14(4,5)11-18/h6-11,15H2,1-5H3,(H,16,17) |
| InChIKey | AAQCNWVRQIQPMA-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|