C10H12F3NO5S2 — CID 102748802
4-methyl-3-[2-(2,2,2-trifluoroethoxy)ethylsulfamoyl]thiophene-2-carboxylic acid (PubChem CID 102748802) has the molecular formula C10H12F3NO5S2 and a molecular weight of 347.34 g/mol. Its IUPAC name is 4-methyl-3-[2-(2,2,2-trifluoroethoxy)ethylsulfamoyl]thiophene-2-carboxylic acid.
| Compound Name | 4-methyl-3-[2-(2,2,2-trifluoroethoxy)ethylsulfamoyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 102748802 |
| Molecular Formula | C10H12F3NO5S2 |
| Molecular Weight | 347.34 g/mol |
| Exact Mass | 347.01 |
| IUPAC Name | 4-methyl-3-[2-(2,2,2-trifluoroethoxy)ethylsulfamoyl]thiophene-2-carboxylic acid |
| SMILES | Cc1csc(C(=O)O)c1S(=O)(=O)NCCOCC(F)(F)F |
| InChI | InChI=1S/C10H12F3NO5S2/c1-6-4-20-7(9(15)16)8(6)21(17,18)14-2-3-19-5-10(11,12)13/h4,14H,2-3,5H2,1H3,(H,15,16) |
| InChIKey | DUJWHNISTJEHOT-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.34 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|