C12H14ClNO2S3 — CID 102750411
2-(chloromethyl)-N,4-dimethyl-N-(thiophen-3-ylmethyl)thiophene-3-sulfonamide (PubChem CID 102750411) has the molecular formula C12H14ClNO2S3 and a molecular weight of 335.90 g/mol. Its IUPAC name is 2-(chloromethyl)-N,4-dimethyl-N-(thiophen-3-ylmethyl)thiophene-3-sulfonamide.
| Compound Name | 2-(chloromethyl)-N,4-dimethyl-N-(thiophen-3-ylmethyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 102750411 |
| Molecular Formula | C12H14ClNO2S3 |
| Molecular Weight | 335.90 g/mol |
| Exact Mass | 334.99 |
| IUPAC Name | 2-(chloromethyl)-N,4-dimethyl-N-(thiophen-3-ylmethyl)thiophene-3-sulfonamide |
| SMILES | Cc1csc(CCl)c1S(=O)(=O)N(C)Cc1ccsc1 |
| InChI | InChI=1S/C12H14ClNO2S3/c1-9-7-18-11(5-13)12(9)19(15,16)14(2)6-10-3-4-17-8-10/h3-4,7-8H,5-6H2,1-2H3 |
| InChIKey | MKCQBAIGTSMYLN-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.90 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|