C10H14ClNO2S2 — CID 102750385
2-(chloromethyl)-N-cyclopropyl-N,4-dimethylthiophene-3-sulfonamide (PubChem CID 102750385) has the molecular formula C10H14ClNO2S2 and a molecular weight of 279.81 g/mol. Its IUPAC name is 2-(chloromethyl)-N-cyclopropyl-N,4-dimethylthiophene-3-sulfonamide.
| Compound Name | 2-(chloromethyl)-N-cyclopropyl-N,4-dimethylthiophene-3-sulfonamide |
|---|---|
| PubChem CID | 102750385 |
| Molecular Formula | C10H14ClNO2S2 |
| Molecular Weight | 279.81 g/mol |
| Exact Mass | 279.02 |
| IUPAC Name | 2-(chloromethyl)-N-cyclopropyl-N,4-dimethylthiophene-3-sulfonamide |
| SMILES | Cc1csc(CCl)c1S(=O)(=O)N(C)C1CC1 |
| InChI | InChI=1S/C10H14ClNO2S2/c1-7-6-15-9(5-11)10(7)16(13,14)12(2)8-3-4-8/h6,8H,3-5H2,1-2H3 |
| InChIKey | BPMQSLQMNRQJJM-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.81 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|