C12H20ClNO2S2 — CID 102750346
2-(chloromethyl)-4-methyl-N,N-dipropylthiophene-3-sulfonamide (PubChem CID 102750346) has the molecular formula C12H20ClNO2S2 and a molecular weight of 309.88 g/mol. Its IUPAC name is 2-(chloromethyl)-4-methyl-N,N-dipropylthiophene-3-sulfonamide.
| Compound Name | 2-(chloromethyl)-4-methyl-N,N-dipropylthiophene-3-sulfonamide |
|---|---|
| PubChem CID | 102750346 |
| Molecular Formula | C12H20ClNO2S2 |
| Molecular Weight | 309.88 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 2-(chloromethyl)-4-methyl-N,N-dipropylthiophene-3-sulfonamide |
| SMILES | CCCN(CCC)S(=O)(=O)c1c(C)csc1CCl |
| InChI | InChI=1S/C12H20ClNO2S2/c1-4-6-14(7-5-2)18(15,16)12-10(3)9-17-11(12)8-13/h9H,4-8H2,1-3H3 |
| InChIKey | IRPMAXFBHXHKLU-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.88 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|