C13H13ClFNO2S2 — CID 102750548
2-(chloromethyl)-N-(2-fluorophenyl)-N,4-dimethylthiophene-3-sulfonamide (PubChem CID 102750548) has the molecular formula C13H13ClFNO2S2 and a molecular weight of 333.84 g/mol. Its IUPAC name is 2-(chloromethyl)-N-(2-fluorophenyl)-N,4-dimethylthiophene-3-sulfonamide.
| Compound Name | 2-(chloromethyl)-N-(2-fluorophenyl)-N,4-dimethylthiophene-3-sulfonamide |
|---|---|
| PubChem CID | 102750548 |
| Molecular Formula | C13H13ClFNO2S2 |
| Molecular Weight | 333.84 g/mol |
| Exact Mass | 333.01 |
| IUPAC Name | 2-(chloromethyl)-N-(2-fluorophenyl)-N,4-dimethylthiophene-3-sulfonamide |
| SMILES | Cc1csc(CCl)c1S(=O)(=O)N(C)c1ccccc1F |
| InChI | InChI=1S/C13H13ClFNO2S2/c1-9-8-19-12(7-14)13(9)20(17,18)16(2)11-6-4-3-5-10(11)15/h3-6,8H,7H2,1-2H3 |
| InChIKey | QSYUWCVKFJOTBS-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.84 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|