About 2-[[3,5-dichloro-6-(ethylamino)-2-pyridinyl]amino]-2-ethylbutan-1-ol
2-[[3,5-dichloro-6-(ethylamino)-2-pyridinyl]amino]-2-ethylbutan-1-ol (PubChem CID 102757921) has the molecular formula C13H21Cl2N3O
and a molecular weight of 306.24 g/mol. Its IUPAC name is 2-[[3,5-dichloro-6-(ethylamino)-2-pyridinyl]amino]-2-ethylbutan-1-ol.
Molecular Properties
| Compound Name | 2-[[3,5-dichloro-6-(ethylamino)-2-pyridinyl]amino]-2-ethylbutan-1-ol |
| PubChem CID | 102757921 |
| Molecular Formula | C13H21Cl2N3O |
| Molecular Weight | 306.24 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | 2-[[3,5-dichloro-6-(ethylamino)-2-pyridinyl]amino]-2-ethylbutan-1-ol |
| SMILES | CCNc1nc(NC(CC)(CC)CO)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H21Cl2N3O/c1-4-13(5-2,8-19)18-12-10(15)7-9(14)11(17-12)16-6-3/h7,19H,4-6,8H2,1-3H3,(H2,16,17,18) |
| InChIKey | QEZBHJRTKFPVMA-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.24 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[3,5-dichloro-6-(ethylamino)-2-pyridinyl]amino]-2-ethylbutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[3,5-dichloro-6-(ethylamino)-2-pyridinyl]amino]-2-ethylbutan-1-ol?
The IUPAC name of 2-[[3,5-dichloro-6-(ethylamino)-2-pyridinyl]amino]-2-ethylbutan-1-ol (CID 102757921) is 2-[[3,5-dichloro-6-(ethylamino)-2-pyridinyl]amino]-2-ethylbutan-1-ol.
What is the SMILES notation for 2-[[3,5-dichloro-6-(ethylamino)-2-pyridinyl]amino]-2-ethylbutan-1-ol?
The canonical SMILES for 2-[[3,5-dichloro-6-(ethylamino)-2-pyridinyl]amino]-2-ethylbutan-1-ol is CCNc1nc(NC(CC)(CC)CO)c(Cl)cc1Cl.
What is the InChIKey of 2-[[3,5-dichloro-6-(ethylamino)-2-pyridinyl]amino]-2-ethylbutan-1-ol?
The InChIKey is QEZBHJRTKFPVMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21Cl2N3O/c1-4-13(5-2,8-19)18-12-10(15)7-9(14)11(17-12)16-6-3/h7,19H,4-6,8H2,1-3H3,(H2,16,17,18).
What are the key properties of 2-[[3,5-dichloro-6-(ethylamino)-2-pyridinyl]amino]-2-ethylbutan-1-ol?
2-[[3,5-dichloro-6-(ethylamino)-2-pyridinyl]amino]-2-ethylbutan-1-ol has a molecular weight of 306.24 g/mol, XLogP of 3.78, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[3,5-dichloro-6-(ethylamino)-2-pyridinyl]amino]-2-ethylbutan-1-ol is sourced from PubChem (CID 102757921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).