C20H22BrN7O — CID 10276061
4-N-(3-bromophenyl)-6-N-(2-morpholin-4-ylethyldiazenyl)quinazoline-4,6-diamine (PubChem CID 10276061) has the molecular formula C20H22BrN7O and a molecular weight of 456.35 g/mol. Its IUPAC name is 4-N-(3-bromophenyl)-6-N-(2-morpholin-4-ylethyldiazenyl)quinazoline-4,6-diamine.
| Compound Name | 4-N-(3-bromophenyl)-6-N-(2-morpholin-4-ylethyldiazenyl)quinazoline-4,6-diamine |
|---|---|
| PubChem CID | 10276061 |
| Molecular Formula | C20H22BrN7O |
| Molecular Weight | 456.35 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | 4-N-(3-bromophenyl)-6-N-(2-morpholin-4-ylethyldiazenyl)quinazoline-4,6-diamine |
| SMILES | Brc1cccc(Nc2ncnc3ccc(N/N=N/CCN4CCOCC4)cc23)c1 |
| InChI | InChI=1S/C20H22BrN7O/c21-15-2-1-3-16(12-15)25-20-18-13-17(4-5-19(18)22-14-23-20)26-27-24-6-7-28-8-10-29-11-9-28/h1-5,12-14H,6-11H2,(H,24,26)(H,22,23,25) |
| InChIKey | CGULORJBJPSDAN-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.35 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|