C10H12Cl2N2OS — CID 102761558
3,5-dichloro-N-ethyl-6-(oxetan-3-ylsulfanyl)pyridin-2-amine (PubChem CID 102761558) has the molecular formula C10H12Cl2N2OS and a molecular weight of 279.19 g/mol. Its IUPAC name is 3,5-dichloro-N-ethyl-6-(oxetan-3-ylsulfanyl)pyridin-2-amine.
| Compound Name | 3,5-dichloro-N-ethyl-6-(oxetan-3-ylsulfanyl)pyridin-2-amine |
|---|---|
| PubChem CID | 102761558 |
| Molecular Formula | C10H12Cl2N2OS |
| Molecular Weight | 279.19 g/mol |
| Exact Mass | 278.00 |
| IUPAC Name | 3,5-dichloro-N-ethyl-6-(oxetan-3-ylsulfanyl)pyridin-2-amine |
| SMILES | CCNc1nc(SC2COC2)c(Cl)cc1Cl |
| InChI | InChI=1S/C10H12Cl2N2OS/c1-2-13-9-7(11)3-8(12)10(14-9)16-6-4-15-5-6/h3,6H,2,4-5H2,1H3,(H,13,14) |
| InChIKey | GLBPIDLYGXYBPE-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.19 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |