C11H9BrF4O3 — CID 102765437
3-bromo-4-(2,2,3,3-tetrafluoropropoxymethyl)benzoic acid (PubChem CID 102765437) has the molecular formula C11H9BrF4O3 and a molecular weight of 345.09 g/mol. Its IUPAC name is 3-bromo-4-(2,2,3,3-tetrafluoropropoxymethyl)benzoic acid.
| Compound Name | 3-bromo-4-(2,2,3,3-tetrafluoropropoxymethyl)benzoic acid |
|---|---|
| PubChem CID | 102765437 |
| Molecular Formula | C11H9BrF4O3 |
| Molecular Weight | 345.09 g/mol |
| Exact Mass | 343.97 |
| IUPAC Name | 3-bromo-4-(2,2,3,3-tetrafluoropropoxymethyl)benzoic acid |
| SMILES | O=C(O)c1ccc(COCC(F)(F)C(F)F)c(Br)c1 |
| InChI | InChI=1S/C11H9BrF4O3/c12-8-3-6(9(17)18)1-2-7(8)4-19-5-11(15,16)10(13)14/h1-3,10H,4-5H2,(H,17,18) |
| InChIKey | WAXCELMQARMZLO-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.09 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|