C12H14BrF4NO — CID 102772439
1-[3-bromo-4-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]-N-methylmethanamine (PubChem CID 102772439) has the molecular formula C12H14BrF4NO and a molecular weight of 344.15 g/mol. Its IUPAC name is 1-[3-bromo-4-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]-N-methylmethanamine.
| Compound Name | 1-[3-bromo-4-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 102772439 |
| Molecular Formula | C12H14BrF4NO |
| Molecular Weight | 344.15 g/mol |
| Exact Mass | 343.02 |
| IUPAC Name | 1-[3-bromo-4-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]-N-methylmethanamine |
| SMILES | CNCc1ccc(COCC(F)(F)C(F)F)c(Br)c1 |
| InChI | InChI=1S/C12H14BrF4NO/c1-18-5-8-2-3-9(10(13)4-8)6-19-7-12(16,17)11(14)15/h2-4,11,18H,5-7H2,1H3 |
| InChIKey | BHWOAUYRZWYSAB-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.15 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|