C14H15BrN2O2S — CID 102766001
ethyl 2-(3-bromoanilino)-2-(4-methyl-1,3-thiazol-5-yl)acetate (PubChem CID 102766001) has the molecular formula C14H15BrN2O2S and a molecular weight of 355.26 g/mol. Its IUPAC name is ethyl 2-(3-bromoanilino)-2-(4-methyl-1,3-thiazol-5-yl)acetate.
| Compound Name | ethyl 2-(3-bromoanilino)-2-(4-methyl-1,3-thiazol-5-yl)acetate |
|---|---|
| PubChem CID | 102766001 |
| Molecular Formula | C14H15BrN2O2S |
| Molecular Weight | 355.26 g/mol |
| Exact Mass | 354.00 |
| IUPAC Name | ethyl 2-(3-bromoanilino)-2-(4-methyl-1,3-thiazol-5-yl)acetate |
| SMILES | CCOC(=O)C(Nc1cccc(Br)c1)c1scnc1C |
| InChI | InChI=1S/C14H15BrN2O2S/c1-3-19-14(18)12(13-9(2)16-8-20-13)17-11-6-4-5-10(15)7-11/h4-8,12,17H,3H2,1-2H3 |
| InChIKey | SVHAYFLWFTWPNZ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.26 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |