C13H13BrN2O2S — CID 102765990
methyl 2-(2-bromoanilino)-2-(4-methyl-1,3-thiazol-5-yl)acetate (PubChem CID 102765990) has the molecular formula C13H13BrN2O2S and a molecular weight of 341.23 g/mol. Its IUPAC name is methyl 2-(2-bromoanilino)-2-(4-methyl-1,3-thiazol-5-yl)acetate.
| Compound Name | methyl 2-(2-bromoanilino)-2-(4-methyl-1,3-thiazol-5-yl)acetate |
|---|---|
| PubChem CID | 102765990 |
| Molecular Formula | C13H13BrN2O2S |
| Molecular Weight | 341.23 g/mol |
| Exact Mass | 339.99 |
| IUPAC Name | methyl 2-(2-bromoanilino)-2-(4-methyl-1,3-thiazol-5-yl)acetate |
| SMILES | COC(=O)C(Nc1ccccc1Br)c1scnc1C |
| InChI | InChI=1S/C13H13BrN2O2S/c1-8-12(19-7-15-8)11(13(17)18-2)16-10-6-4-3-5-9(10)14/h3-7,11,16H,1-2H3 |
| InChIKey | MMNAVFOGBROLNR-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.23 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |