About ethyl 2-(3-bromo-4-chloroanilino)-2-(4-methyl-1,3-thiazol-5-yl)acetate
ethyl 2-(3-bromo-4-chloroanilino)-2-(4-methyl-1,3-thiazol-5-yl)acetate (PubChem CID 102766129) has the molecular formula C14H14BrClN2O2S
and a molecular weight of 389.70 g/mol. Its IUPAC name is ethyl 2-(3-bromo-4-chloroanilino)-2-(4-methyl-1,3-thiazol-5-yl)acetate.
Molecular Properties
| Compound Name | ethyl 2-(3-bromo-4-chloroanilino)-2-(4-methyl-1,3-thiazol-5-yl)acetate |
| PubChem CID | 102766129 |
| Molecular Formula | C14H14BrClN2O2S |
| Molecular Weight | 389.70 g/mol |
| Exact Mass | 387.96 |
| IUPAC Name | ethyl 2-(3-bromo-4-chloroanilino)-2-(4-methyl-1,3-thiazol-5-yl)acetate |
| SMILES | CCOC(=O)C(Nc1ccc(Cl)c(Br)c1)c1scnc1C |
| InChI | InChI=1S/C14H14BrClN2O2S/c1-3-20-14(19)12(13-8(2)17-7-21-13)18-9-4-5-11(16)10(15)6-9/h4-7,12,18H,3H2,1-2H3 |
| InChIKey | FOTDZKPDVYIXDY-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.70 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 2-(3-bromo-4-chloroanilino)-2-(4-methyl-1,3-thiazol-5-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(3-bromo-4-chloroanilino)-2-(4-methyl-1,3-thiazol-5-yl)acetate?
The IUPAC name of ethyl 2-(3-bromo-4-chloroanilino)-2-(4-methyl-1,3-thiazol-5-yl)acetate (CID 102766129) is ethyl 2-(3-bromo-4-chloroanilino)-2-(4-methyl-1,3-thiazol-5-yl)acetate.
What is the SMILES notation for ethyl 2-(3-bromo-4-chloroanilino)-2-(4-methyl-1,3-thiazol-5-yl)acetate?
The canonical SMILES for ethyl 2-(3-bromo-4-chloroanilino)-2-(4-methyl-1,3-thiazol-5-yl)acetate is CCOC(=O)C(Nc1ccc(Cl)c(Br)c1)c1scnc1C.
What is the InChIKey of ethyl 2-(3-bromo-4-chloroanilino)-2-(4-methyl-1,3-thiazol-5-yl)acetate?
The InChIKey is FOTDZKPDVYIXDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14BrClN2O2S/c1-3-20-14(19)12(13-8(2)17-7-21-13)18-9-4-5-11(16)10(15)6-9/h4-7,12,18H,3H2,1-2H3.
What are the key properties of ethyl 2-(3-bromo-4-chloroanilino)-2-(4-methyl-1,3-thiazol-5-yl)acetate?
ethyl 2-(3-bromo-4-chloroanilino)-2-(4-methyl-1,3-thiazol-5-yl)acetate has a molecular weight of 389.70 g/mol, XLogP of 4.58, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(3-bromo-4-chloroanilino)-2-(4-methyl-1,3-thiazol-5-yl)acetate is sourced from PubChem (CID 102766129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).