C9H16N4OS — CID 102768070
2-[(5-amino-1,3-thiazol-2-yl)-butylamino]acetamide (PubChem CID 102768070) has the molecular formula C9H16N4OS and a molecular weight of 228.32 g/mol. Its IUPAC name is 2-[(5-amino-1,3-thiazol-2-yl)-butylamino]acetamide.
| Compound Name | 2-[(5-amino-1,3-thiazol-2-yl)-butylamino]acetamide |
|---|---|
| PubChem CID | 102768070 |
| Molecular Formula | C9H16N4OS |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 2-[(5-amino-1,3-thiazol-2-yl)-butylamino]acetamide |
| SMILES | CCCCN(CC(N)=O)c1ncc(N)s1 |
| InChI | InChI=1S/C9H16N4OS/c1-2-3-4-13(6-7(10)14)9-12-5-8(11)15-9/h5H,2-4,6,11H2,1H3,(H2,10,14) |
| InChIKey | BVIKGZHXLZGFKF-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 85.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |