C12H18N4O3 — CID 114214276
methyl 4-[(2-amino-2-oxoethyl)-butylamino]pyrimidine-5-carboxylate (PubChem CID 114214276) has the molecular formula C12H18N4O3 and a molecular weight of 266.30 g/mol. Its IUPAC name is methyl 4-[(2-amino-2-oxoethyl)-butylamino]pyrimidine-5-carboxylate.
| Compound Name | methyl 4-[(2-amino-2-oxoethyl)-butylamino]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 114214276 |
| Molecular Formula | C12H18N4O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | methyl 4-[(2-amino-2-oxoethyl)-butylamino]pyrimidine-5-carboxylate |
| SMILES | CCCCN(CC(N)=O)c1ncncc1C(=O)OC |
| InChI | InChI=1S/C12H18N4O3/c1-3-4-5-16(7-10(13)17)11-9(12(18)19-2)6-14-8-15-11/h6,8H,3-5,7H2,1-2H3,(H2,13,17) |
| InChIKey | ADOOIKVVYHLENW-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 98.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |