C9H11N3O4S — CID 102769699
3-[cyclopropyl-(5-nitro-1,3-thiazol-2-yl)amino]propanoic acid (PubChem CID 102769699) has the molecular formula C9H11N3O4S and a molecular weight of 257.27 g/mol. Its IUPAC name is 3-[cyclopropyl-(5-nitro-1,3-thiazol-2-yl)amino]propanoic acid.
| Compound Name | 3-[cyclopropyl-(5-nitro-1,3-thiazol-2-yl)amino]propanoic acid |
|---|---|
| PubChem CID | 102769699 |
| Molecular Formula | C9H11N3O4S |
| Molecular Weight | 257.27 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 3-[cyclopropyl-(5-nitro-1,3-thiazol-2-yl)amino]propanoic acid |
| SMILES | O=C(O)CCN(c1ncc([N+](=O)[O-])s1)C1CC1 |
| InChI | InChI=1S/C9H11N3O4S/c13-8(14)3-4-11(6-1-2-6)9-10-5-7(17-9)12(15)16/h5-6H,1-4H2,(H,13,14) |
| InChIKey | LKKBBYCBIONGAI-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 96.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.27 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|