C26H17ClN4O4 — CID 10277777
1-(1,3-benzodioxol-5-yl)-8-[(2-chlorobenzoyl)amino]benzo[g]indazole-3-carboxamide (PubChem CID 10277777) has the molecular formula C26H17ClN4O4 and a molecular weight of 484.90 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-8-[(2-chlorobenzoyl)amino]benzo[g]indazole-3-carboxamide.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-8-[(2-chlorobenzoyl)amino]benzo[g]indazole-3-carboxamide |
|---|---|
| PubChem CID | 10277777 |
| Molecular Formula | C26H17ClN4O4 |
| Molecular Weight | 484.90 g/mol |
| Exact Mass | 484.09 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-8-[(2-chlorobenzoyl)amino]benzo[g]indazole-3-carboxamide |
| SMILES | NC(=O)c1nn(-c2ccc3c(c2)OCO3)c2c1ccc1ccc(NC(=O)c3ccccc3Cl)cc12 |
| InChI | InChI=1S/C26H17ClN4O4/c27-20-4-2-1-3-17(20)26(33)29-15-7-5-14-6-9-18-23(25(28)32)30-31(24(18)19(14)11-15)16-8-10-21-22(12-16)35-13-34-21/h1-12H,13H2,(H2,28,32)(H,29,33) |
| InChIKey | IRJIRVSKERCRMY-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.90 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |