C26H18ClN3O2S — CID 142224443
2-chloro-N-[3-formyl-1-(4-methylsulfanylphenyl)benzo[g]indazol-8-yl]benzamide (PubChem CID 142224443) has the molecular formula C26H18ClN3O2S and a molecular weight of 471.97 g/mol. Its IUPAC name is 2-chloro-N-[3-formyl-1-(4-methylsulfanylphenyl)benzo[g]indazol-8-yl]benzamide.
| Compound Name | 2-chloro-N-[3-formyl-1-(4-methylsulfanylphenyl)benzo[g]indazol-8-yl]benzamide |
|---|---|
| PubChem CID | 142224443 |
| Molecular Formula | C26H18ClN3O2S |
| Molecular Weight | 471.97 g/mol |
| Exact Mass | 471.08 |
| IUPAC Name | 2-chloro-N-[3-formyl-1-(4-methylsulfanylphenyl)benzo[g]indazol-8-yl]benzamide |
| SMILES | CSc1ccc(-n2nc(C=O)c3ccc4ccc(NC(=O)c5ccccc5Cl)cc4c32)cc1 |
| InChI | InChI=1S/C26H18ClN3O2S/c1-33-19-11-9-18(10-12-19)30-25-21(24(15-31)29-30)13-7-16-6-8-17(14-22(16)25)28-26(32)20-4-2-3-5-23(20)27/h2-15H,1H3,(H,28,32) |
| InChIKey | LFAMJLPZYTWXCQ-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.97 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|