C13H21N3O2S — CID 102784557
(4-tert-butylthiadiazol-5-yl)-[2-(hydroxymethyl)-3-methylpyrrolidin-1-yl]methanone (PubChem CID 102784557) has the molecular formula C13H21N3O2S and a molecular weight of 283.40 g/mol. Its IUPAC name is (4-tert-butylthiadiazol-5-yl)-[2-(hydroxymethyl)-3-methylpyrrolidin-1-yl]methanone.
| Compound Name | (4-tert-butylthiadiazol-5-yl)-[2-(hydroxymethyl)-3-methylpyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 102784557 |
| Molecular Formula | C13H21N3O2S |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | (4-tert-butylthiadiazol-5-yl)-[2-(hydroxymethyl)-3-methylpyrrolidin-1-yl]methanone |
| SMILES | CC1CCN(C(=O)c2snnc2C(C)(C)C)C1CO |
| InChI | InChI=1S/C13H21N3O2S/c1-8-5-6-16(9(8)7-17)12(18)10-11(13(2,3)4)14-15-19-10/h8-9,17H,5-7H2,1-4H3 |
| InChIKey | BUBWMUJEBMFESL-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |