C23H21IN2O3 — CID 10278637
5-(4-iodophenyl)-5-methyl-3-[(3-phenylmethoxy-2-pyridinyl)amino]oxolan-2-one (PubChem CID 10278637) has the molecular formula C23H21IN2O3 and a molecular weight of 500.34 g/mol. Its IUPAC name is 5-(4-iodophenyl)-5-methyl-3-[(3-phenylmethoxy-2-pyridinyl)amino]oxolan-2-one.
| Compound Name | 5-(4-iodophenyl)-5-methyl-3-[(3-phenylmethoxy-2-pyridinyl)amino]oxolan-2-one |
|---|---|
| PubChem CID | 10278637 |
| Molecular Formula | C23H21IN2O3 |
| Molecular Weight | 500.34 g/mol |
| Exact Mass | 500.06 |
| IUPAC Name | 5-(4-iodophenyl)-5-methyl-3-[(3-phenylmethoxy-2-pyridinyl)amino]oxolan-2-one |
| SMILES | CC1(c2ccc(I)cc2)CC(Nc2ncccc2OCc2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C23H21IN2O3/c1-23(17-9-11-18(24)12-10-17)14-19(22(27)29-23)26-21-20(8-5-13-25-21)28-15-16-6-3-2-4-7-16/h2-13,19H,14-15H2,1H3,(H,25,26) |
| InChIKey | DLWPISLCPOMXSR-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.34 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|