C18H16INO4 — CID 42578699
5-iodo-2-[[(3S,5S)-5-methyl-2-oxo-5-phenyloxolan-3-yl]amino]benzoic acid (PubChem CID 42578699) has the molecular formula C18H16INO4 and a molecular weight of 437.23 g/mol. Its IUPAC name is 5-iodo-2-[[(3S,5S)-5-methyl-2-oxo-5-phenyloxolan-3-yl]amino]benzoic acid.
| Compound Name | 5-iodo-2-[[(3S,5S)-5-methyl-2-oxo-5-phenyloxolan-3-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 42578699 |
| Molecular Formula | C18H16INO4 |
| Molecular Weight | 437.23 g/mol |
| Exact Mass | 437.01 |
| IUPAC Name | 5-iodo-2-[[(3S,5S)-5-methyl-2-oxo-5-phenyloxolan-3-yl]amino]benzoic acid |
| SMILES | C[C@@]1(c2ccccc2)C[C@H](Nc2ccc(I)cc2C(=O)O)C(=O)O1 |
| InChI | InChI=1S/C18H16INO4/c1-18(11-5-3-2-4-6-11)10-15(17(23)24-18)20-14-8-7-12(19)9-13(14)16(21)22/h2-9,15,20H,10H2,1H3,(H,21,22)/t15-,18-/m0/s1 |
| InChIKey | BUPYJCMKAHHTOT-YJBOKZPZSA-N |
| XLogP | 3.63 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.23 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|