C24H21IO5 — CID 129073286
1-iodo-4-phenylmethoxybenzene;2-methyl-2-phenyl-1,3-dioxane-4,6-dione (PubChem CID 129073286) has the molecular formula C24H21IO5 and a molecular weight of 516.33 g/mol. Its IUPAC name is 1-iodo-4-phenylmethoxybenzene;2-methyl-2-phenyl-1,3-dioxane-4,6-dione.
| Compound Name | 1-iodo-4-phenylmethoxybenzene;2-methyl-2-phenyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 129073286 |
| Molecular Formula | C24H21IO5 |
| Molecular Weight | 516.33 g/mol |
| Exact Mass | 516.04 |
| IUPAC Name | 1-iodo-4-phenylmethoxybenzene;2-methyl-2-phenyl-1,3-dioxane-4,6-dione |
| SMILES | CC1(c2ccccc2)OC(=O)CC(=O)O1.Ic1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C13H11IO.C11H10O4/c14-12-6-8-13(9-7-12)15-10-11-4-2-1-3-5-11;1-11(8-5-3-2-4-6-8)14-9(12)7-10(13)15-11/h1-9H,10H2;2-6H,7H2,1H3 |
| InChIKey | RFBDBHXVWSNBOF-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.33 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|