C22H23IO5 — CID 129073295
1,5-dioxaspiro[5.5]undecane-2,4-dione;1-iodo-2-phenylmethoxybenzene (PubChem CID 129073295) has the molecular formula C22H23IO5 and a molecular weight of 494.33 g/mol. Its IUPAC name is 1,5-dioxaspiro[5.5]undecane-2,4-dione;1-iodo-2-phenylmethoxybenzene.
| Compound Name | 1,5-dioxaspiro[5.5]undecane-2,4-dione;1-iodo-2-phenylmethoxybenzene |
|---|---|
| PubChem CID | 129073295 |
| Molecular Formula | C22H23IO5 |
| Molecular Weight | 494.33 g/mol |
| Exact Mass | 494.06 |
| IUPAC Name | 1,5-dioxaspiro[5.5]undecane-2,4-dione;1-iodo-2-phenylmethoxybenzene |
| SMILES | Ic1ccccc1OCc1ccccc1.O=C1CC(=O)OC2(CCCCC2)O1 |
| InChI | InChI=1S/C13H11IO.C9H12O4/c14-12-8-4-5-9-13(12)15-10-11-6-2-1-3-7-11;10-7-6-8(11)13-9(12-7)4-2-1-3-5-9/h1-9H,10H2;1-6H2 |
| InChIKey | VXZWKQYLVAQKFS-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.33 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|