C27H25F6NO2 — CID 10279124
4-benzyl-2-[2-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenylmorpholine (PubChem CID 10279124) has the molecular formula C27H25F6NO2 and a molecular weight of 509.49 g/mol. Its IUPAC name is 4-benzyl-2-[2-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenylmorpholine.
| Compound Name | 4-benzyl-2-[2-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenylmorpholine |
|---|---|
| PubChem CID | 10279124 |
| Molecular Formula | C27H25F6NO2 |
| Molecular Weight | 509.49 g/mol |
| Exact Mass | 509.18 |
| IUPAC Name | 4-benzyl-2-[2-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenylmorpholine |
| SMILES | FC(F)(F)c1cc(CCOC2OCCN(Cc3ccccc3)C2c2ccccc2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H25F6NO2/c28-26(29,30)22-15-20(16-23(17-22)27(31,32)33)11-13-35-25-24(21-9-5-2-6-10-21)34(12-14-36-25)18-19-7-3-1-4-8-19/h1-10,15-17,24-25H,11-14,18H2 |
| InChIKey | NUWCHSGDSQGBMX-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.49 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |