C10H15N5 — CID 102795442
5-amino-3-(1-cyclopropylethylamino)-1-methylpyrazole-4-carbonitrile (PubChem CID 102795442) has the molecular formula C10H15N5 and a molecular weight of 205.26 g/mol. Its IUPAC name is 5-amino-3-(1-cyclopropylethylamino)-1-methylpyrazole-4-carbonitrile.
| Compound Name | 5-amino-3-(1-cyclopropylethylamino)-1-methylpyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 102795442 |
| Molecular Formula | C10H15N5 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | 5-amino-3-(1-cyclopropylethylamino)-1-methylpyrazole-4-carbonitrile |
| SMILES | CC(Nc1nn(C)c(N)c1C#N)C1CC1 |
| InChI | InChI=1S/C10H15N5/c1-6(7-3-4-7)13-10-8(5-11)9(12)15(2)14-10/h6-7H,3-4,12H2,1-2H3,(H,13,14) |
| InChIKey | QCCKABMNNVKZJU-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 79.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |