C11H21N5 — CID 102797756
(3R)-1-(5-butan-2-yl-1H-1,2,4-triazol-3-yl)-3-methylpiperazine (PubChem CID 102797756) has the molecular formula C11H21N5 and a molecular weight of 223.32 g/mol. Its IUPAC name is (3R)-1-(5-butan-2-yl-1H-1,2,4-triazol-3-yl)-3-methylpiperazine.
| Compound Name | (3R)-1-(5-butan-2-yl-1H-1,2,4-triazol-3-yl)-3-methylpiperazine |
|---|---|
| PubChem CID | 102797756 |
| Molecular Formula | C11H21N5 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.18 |
| IUPAC Name | (3R)-1-(5-butan-2-yl-1H-1,2,4-triazol-3-yl)-3-methylpiperazine |
| SMILES | CCC(C)c1nc(N2CCN[C@H](C)C2)n[nH]1 |
| InChI | InChI=1S/C11H21N5/c1-4-8(2)10-13-11(15-14-10)16-6-5-12-9(3)7-16/h8-9,12H,4-7H2,1-3H3,(H,13,14,15)/t8?,9-/m1/s1 |
| InChIKey | HYSMSZKKVAIDIR-YGPZHTELSA-N |
| XLogP | 1.12 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |