C14H27N5 — CID 102797599
(3R)-1-(5-heptyl-1H-1,2,4-triazol-3-yl)-3-methylpiperazine (PubChem CID 102797599) has the molecular formula C14H27N5 and a molecular weight of 265.40 g/mol. Its IUPAC name is (3R)-1-(5-heptyl-1H-1,2,4-triazol-3-yl)-3-methylpiperazine.
| Compound Name | (3R)-1-(5-heptyl-1H-1,2,4-triazol-3-yl)-3-methylpiperazine |
|---|---|
| PubChem CID | 102797599 |
| Molecular Formula | C14H27N5 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.23 |
| IUPAC Name | (3R)-1-(5-heptyl-1H-1,2,4-triazol-3-yl)-3-methylpiperazine |
| SMILES | CCCCCCCc1nc(N2CCN[C@H](C)C2)n[nH]1 |
| InChI | InChI=1S/C14H27N5/c1-3-4-5-6-7-8-13-16-14(18-17-13)19-10-9-15-12(2)11-19/h12,15H,3-11H2,1-2H3,(H,16,17,18)/t12-/m1/s1 |
| InChIKey | LHQCMPCNMZLYOM-GFCCVEGCSA-N |
| XLogP | 2.12 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|