C13H25N5 — CID 102800741
[1-(5-pentyl-1H-1,2,4-triazol-3-yl)piperidin-4-yl]methanamine (PubChem CID 102800741) has the molecular formula C13H25N5 and a molecular weight of 251.38 g/mol. Its IUPAC name is [1-(5-pentyl-1H-1,2,4-triazol-3-yl)piperidin-4-yl]methanamine.
| Compound Name | [1-(5-pentyl-1H-1,2,4-triazol-3-yl)piperidin-4-yl]methanamine |
|---|---|
| PubChem CID | 102800741 |
| Molecular Formula | C13H25N5 |
| Molecular Weight | 251.38 g/mol |
| Exact Mass | 251.21 |
| IUPAC Name | [1-(5-pentyl-1H-1,2,4-triazol-3-yl)piperidin-4-yl]methanamine |
| SMILES | CCCCCc1nc(N2CCC(CN)CC2)n[nH]1 |
| InChI | InChI=1S/C13H25N5/c1-2-3-4-5-12-15-13(17-16-12)18-8-6-11(10-14)7-9-18/h11H,2-10,14H2,1H3,(H,15,16,17) |
| InChIKey | HUQKUXFJITVHPP-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.38 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|