C11H21N5 — CID 102793292
1-(5-pentyl-1H-1,2,4-triazol-3-yl)pyrrolidin-3-amine (PubChem CID 102793292) has the molecular formula C11H21N5 and a molecular weight of 223.32 g/mol. Its IUPAC name is 1-(5-pentyl-1H-1,2,4-triazol-3-yl)pyrrolidin-3-amine.
| Compound Name | 1-(5-pentyl-1H-1,2,4-triazol-3-yl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 102793292 |
| Molecular Formula | C11H21N5 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.18 |
| IUPAC Name | 1-(5-pentyl-1H-1,2,4-triazol-3-yl)pyrrolidin-3-amine |
| SMILES | CCCCCc1nc(N2CCC(N)C2)n[nH]1 |
| InChI | InChI=1S/C11H21N5/c1-2-3-4-5-10-13-11(15-14-10)16-7-6-9(12)8-16/h9H,2-8,12H2,1H3,(H,13,14,15) |
| InChIKey | IDBFZDGQVPTVCS-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|