About 2-methyl-1-(5-octyl-1H-1,2,4-triazol-3-yl)piperidin-3-amine
2-methyl-1-(5-octyl-1H-1,2,4-triazol-3-yl)piperidin-3-amine (PubChem CID 102798574) has the molecular formula C16H31N5
and a molecular weight of 293.46 g/mol. Its IUPAC name is 2-methyl-1-(5-octyl-1H-1,2,4-triazol-3-yl)piperidin-3-amine.
Molecular Properties
| Compound Name | 2-methyl-1-(5-octyl-1H-1,2,4-triazol-3-yl)piperidin-3-amine |
| PubChem CID | 102798574 |
| Molecular Formula | C16H31N5 |
| Molecular Weight | 293.46 g/mol |
| Exact Mass | 293.26 |
| IUPAC Name | 2-methyl-1-(5-octyl-1H-1,2,4-triazol-3-yl)piperidin-3-amine |
| SMILES | CCCCCCCCc1nc(N2CCCC(N)C2C)n[nH]1 |
| InChI | InChI=1S/C16H31N5/c1-3-4-5-6-7-8-11-15-18-16(20-19-15)21-12-9-10-14(17)13(21)2/h13-14H,3-12,17H2,1-2H3,(H,18,19,20) |
| InChIKey | WVEXYGXMNODBRA-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.46 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-1-(5-octyl-1H-1,2,4-triazol-3-yl)piperidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1-(5-octyl-1H-1,2,4-triazol-3-yl)piperidin-3-amine?
The IUPAC name of 2-methyl-1-(5-octyl-1H-1,2,4-triazol-3-yl)piperidin-3-amine (CID 102798574) is 2-methyl-1-(5-octyl-1H-1,2,4-triazol-3-yl)piperidin-3-amine.
What is the SMILES notation for 2-methyl-1-(5-octyl-1H-1,2,4-triazol-3-yl)piperidin-3-amine?
The canonical SMILES for 2-methyl-1-(5-octyl-1H-1,2,4-triazol-3-yl)piperidin-3-amine is CCCCCCCCc1nc(N2CCCC(N)C2C)n[nH]1.
What is the InChIKey of 2-methyl-1-(5-octyl-1H-1,2,4-triazol-3-yl)piperidin-3-amine?
The InChIKey is WVEXYGXMNODBRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H31N5/c1-3-4-5-6-7-8-11-15-18-16(20-19-15)21-12-9-10-14(17)13(21)2/h13-14H,3-12,17H2,1-2H3,(H,18,19,20).
What are the key properties of 2-methyl-1-(5-octyl-1H-1,2,4-triazol-3-yl)piperidin-3-amine?
2-methyl-1-(5-octyl-1H-1,2,4-triazol-3-yl)piperidin-3-amine has a molecular weight of 293.46 g/mol, XLogP of 3.02, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1-(5-octyl-1H-1,2,4-triazol-3-yl)piperidin-3-amine is sourced from PubChem (CID 102798574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).