C14H27N5 — CID 102800743
[1-(5-hexyl-1H-1,2,4-triazol-3-yl)piperidin-4-yl]methanamine (PubChem CID 102800743) has the molecular formula C14H27N5 and a molecular weight of 265.40 g/mol. Its IUPAC name is [1-(5-hexyl-1H-1,2,4-triazol-3-yl)piperidin-4-yl]methanamine.
| Compound Name | [1-(5-hexyl-1H-1,2,4-triazol-3-yl)piperidin-4-yl]methanamine |
|---|---|
| PubChem CID | 102800743 |
| Molecular Formula | C14H27N5 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.23 |
| IUPAC Name | [1-(5-hexyl-1H-1,2,4-triazol-3-yl)piperidin-4-yl]methanamine |
| SMILES | CCCCCCc1nc(N2CCC(CN)CC2)n[nH]1 |
| InChI | InChI=1S/C14H27N5/c1-2-3-4-5-6-13-16-14(18-17-13)19-9-7-12(11-15)8-10-19/h12H,2-11,15H2,1H3,(H,16,17,18) |
| InChIKey | ZJIUHUQJHGMVRR-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|