C15H29N5 — CID 102800942
[1-(5-hexyl-1H-1,2,4-triazol-3-yl)-4-methylpiperidin-4-yl]methanamine (PubChem CID 102800942) has the molecular formula C15H29N5 and a molecular weight of 279.43 g/mol. Its IUPAC name is [1-(5-hexyl-1H-1,2,4-triazol-3-yl)-4-methylpiperidin-4-yl]methanamine.
| Compound Name | [1-(5-hexyl-1H-1,2,4-triazol-3-yl)-4-methylpiperidin-4-yl]methanamine |
|---|---|
| PubChem CID | 102800942 |
| Molecular Formula | C15H29N5 |
| Molecular Weight | 279.43 g/mol |
| Exact Mass | 279.24 |
| IUPAC Name | [1-(5-hexyl-1H-1,2,4-triazol-3-yl)-4-methylpiperidin-4-yl]methanamine |
| SMILES | CCCCCCc1nc(N2CCC(C)(CN)CC2)n[nH]1 |
| InChI | InChI=1S/C15H29N5/c1-3-4-5-6-7-13-17-14(19-18-13)20-10-8-15(2,12-16)9-11-20/h3-12,16H2,1-2H3,(H,17,18,19) |
| InChIKey | LPOCFURZBUMWPD-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.43 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|