C16H31N5 — CID 102799158
1-[1-(5-heptyl-1H-1,2,4-triazol-3-yl)piperidin-4-yl]ethanamine (PubChem CID 102799158) has the molecular formula C16H31N5 and a molecular weight of 293.46 g/mol. Its IUPAC name is 1-[1-(5-heptyl-1H-1,2,4-triazol-3-yl)piperidin-4-yl]ethanamine.
| Compound Name | 1-[1-(5-heptyl-1H-1,2,4-triazol-3-yl)piperidin-4-yl]ethanamine |
|---|---|
| PubChem CID | 102799158 |
| Molecular Formula | C16H31N5 |
| Molecular Weight | 293.46 g/mol |
| Exact Mass | 293.26 |
| IUPAC Name | 1-[1-(5-heptyl-1H-1,2,4-triazol-3-yl)piperidin-4-yl]ethanamine |
| SMILES | CCCCCCCc1nc(N2CCC(C(C)N)CC2)n[nH]1 |
| InChI | InChI=1S/C16H31N5/c1-3-4-5-6-7-8-15-18-16(20-19-15)21-11-9-14(10-12-21)13(2)17/h13-14H,3-12,17H2,1-2H3,(H,18,19,20) |
| InChIKey | PFEDWEIENRDLJW-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.46 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|