C11H19F2N5O — CID 103207019
1-[5-[2-(2,2-difluoroethoxy)ethyl]-1H-1,2,4-triazol-3-yl]-3-methylpiperazine (PubChem CID 103207019) has the molecular formula C11H19F2N5O and a molecular weight of 275.30 g/mol. Its IUPAC name is 1-[5-[2-(2,2-difluoroethoxy)ethyl]-1H-1,2,4-triazol-3-yl]-3-methylpiperazine.
| Compound Name | 1-[5-[2-(2,2-difluoroethoxy)ethyl]-1H-1,2,4-triazol-3-yl]-3-methylpiperazine |
|---|---|
| PubChem CID | 103207019 |
| Molecular Formula | C11H19F2N5O |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 1-[5-[2-(2,2-difluoroethoxy)ethyl]-1H-1,2,4-triazol-3-yl]-3-methylpiperazine |
| SMILES | CC1CN(c2n[nH]c(CCOCC(F)F)n2)CCN1 |
| InChI | InChI=1S/C11H19F2N5O/c1-8-6-18(4-3-14-8)11-15-10(16-17-11)2-5-19-7-9(12)13/h8-9,14H,2-7H2,1H3,(H,15,16,17) |
| InChIKey | WZECQBNUTGEHOO-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|