C15H20IN5 — CID 102799263
1-[1-[5-(4-iodophenyl)-1H-1,2,4-triazol-3-yl]piperidin-4-yl]ethanamine (PubChem CID 102799263) has the molecular formula C15H20IN5 and a molecular weight of 397.26 g/mol. Its IUPAC name is 1-[1-[5-(4-iodophenyl)-1H-1,2,4-triazol-3-yl]piperidin-4-yl]ethanamine.
| Compound Name | 1-[1-[5-(4-iodophenyl)-1H-1,2,4-triazol-3-yl]piperidin-4-yl]ethanamine |
|---|---|
| PubChem CID | 102799263 |
| Molecular Formula | C15H20IN5 |
| Molecular Weight | 397.26 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | 1-[1-[5-(4-iodophenyl)-1H-1,2,4-triazol-3-yl]piperidin-4-yl]ethanamine |
| SMILES | CC(N)C1CCN(c2n[nH]c(-c3ccc(I)cc3)n2)CC1 |
| InChI | InChI=1S/C15H20IN5/c1-10(17)11-6-8-21(9-7-11)15-18-14(19-20-15)12-2-4-13(16)5-3-12/h2-5,10-11H,6-9,17H2,1H3,(H,18,19,20) |
| InChIKey | AKWVVYDTRKUQLR-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.26 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|