C11H19N3 — CID 102804044
1-(1,3-dimethylpyrazol-4-yl)-N,3-dimethylbut-2-en-1-amine (PubChem CID 102804044) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is 1-(1,3-dimethylpyrazol-4-yl)-N,3-dimethylbut-2-en-1-amine.
| Compound Name | 1-(1,3-dimethylpyrazol-4-yl)-N,3-dimethylbut-2-en-1-amine |
|---|---|
| PubChem CID | 102804044 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | 1-(1,3-dimethylpyrazol-4-yl)-N,3-dimethylbut-2-en-1-amine |
| SMILES | CNC(C=C(C)C)c1cn(C)nc1C |
| InChI | InChI=1S/C11H19N3/c1-8(2)6-11(12-4)10-7-14(5)13-9(10)3/h6-7,11-12H,1-5H3 |
| InChIKey | ATDBIVDBYKGKPQ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|