About 1-(1,3-dimethylpyrazol-4-yl)-4-methoxy-N,2-dimethylbutan-1-amine
1-(1,3-dimethylpyrazol-4-yl)-4-methoxy-N,2-dimethylbutan-1-amine (PubChem CID 102804528) has the molecular formula C12H23N3O
and a molecular weight of 225.34 g/mol. Its IUPAC name is 1-(1,3-dimethylpyrazol-4-yl)-4-methoxy-N,2-dimethylbutan-1-amine.
Molecular Properties
| Compound Name | 1-(1,3-dimethylpyrazol-4-yl)-4-methoxy-N,2-dimethylbutan-1-amine |
| PubChem CID | 102804528 |
| Molecular Formula | C12H23N3O |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.18 |
| IUPAC Name | 1-(1,3-dimethylpyrazol-4-yl)-4-methoxy-N,2-dimethylbutan-1-amine |
| SMILES | CNC(c1cn(C)nc1C)C(C)CCOC |
| InChI | InChI=1S/C12H23N3O/c1-9(6-7-16-5)12(13-3)11-8-15(4)14-10(11)2/h8-9,12-13H,6-7H2,1-5H3 |
| InChIKey | LCCLFIGRCNIBIZ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(1,3-dimethylpyrazol-4-yl)-4-methoxy-N,2-dimethylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,3-dimethylpyrazol-4-yl)-4-methoxy-N,2-dimethylbutan-1-amine?
The IUPAC name of 1-(1,3-dimethylpyrazol-4-yl)-4-methoxy-N,2-dimethylbutan-1-amine (CID 102804528) is 1-(1,3-dimethylpyrazol-4-yl)-4-methoxy-N,2-dimethylbutan-1-amine.
What is the SMILES notation for 1-(1,3-dimethylpyrazol-4-yl)-4-methoxy-N,2-dimethylbutan-1-amine?
The canonical SMILES for 1-(1,3-dimethylpyrazol-4-yl)-4-methoxy-N,2-dimethylbutan-1-amine is CNC(c1cn(C)nc1C)C(C)CCOC.
What is the InChIKey of 1-(1,3-dimethylpyrazol-4-yl)-4-methoxy-N,2-dimethylbutan-1-amine?
The InChIKey is LCCLFIGRCNIBIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N3O/c1-9(6-7-16-5)12(13-3)11-8-15(4)14-10(11)2/h8-9,12-13H,6-7H2,1-5H3.
What are the key properties of 1-(1,3-dimethylpyrazol-4-yl)-4-methoxy-N,2-dimethylbutan-1-amine?
1-(1,3-dimethylpyrazol-4-yl)-4-methoxy-N,2-dimethylbutan-1-amine has a molecular weight of 225.34 g/mol, XLogP of 1.66, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,3-dimethylpyrazol-4-yl)-4-methoxy-N,2-dimethylbutan-1-amine is sourced from PubChem (CID 102804528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).