C12H16ClN5 — CID 102805005
[2-(3-chloro-4-pyridinyl)-1-(1,3-dimethylpyrazol-4-yl)ethyl]hydrazine (PubChem CID 102805005) has the molecular formula C12H16ClN5 and a molecular weight of 265.75 g/mol. Its IUPAC name is [2-(3-chloro-4-pyridinyl)-1-(1,3-dimethylpyrazol-4-yl)ethyl]hydrazine.
| Compound Name | [2-(3-chloro-4-pyridinyl)-1-(1,3-dimethylpyrazol-4-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 102805005 |
| Molecular Formula | C12H16ClN5 |
| Molecular Weight | 265.75 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | [2-(3-chloro-4-pyridinyl)-1-(1,3-dimethylpyrazol-4-yl)ethyl]hydrazine |
| SMILES | Cc1nn(C)cc1C(Cc1ccncc1Cl)NN |
| InChI | InChI=1S/C12H16ClN5/c1-8-10(7-18(2)17-8)12(16-14)5-9-3-4-15-6-11(9)13/h3-4,6-7,12,16H,5,14H2,1-2H3 |
| InChIKey | XYPHHAXUAOIYNB-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.75 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|