C14H13ClF3N3 — CID 105314802
[2-(3-chloro-4-pyridinyl)-1-[2-(trifluoromethyl)phenyl]ethyl]hydrazine (PubChem CID 105314802) has the molecular formula C14H13ClF3N3 and a molecular weight of 315.73 g/mol. Its IUPAC name is [2-(3-chloro-4-pyridinyl)-1-[2-(trifluoromethyl)phenyl]ethyl]hydrazine.
| Compound Name | [2-(3-chloro-4-pyridinyl)-1-[2-(trifluoromethyl)phenyl]ethyl]hydrazine |
|---|---|
| PubChem CID | 105314802 |
| Molecular Formula | C14H13ClF3N3 |
| Molecular Weight | 315.73 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | [2-(3-chloro-4-pyridinyl)-1-[2-(trifluoromethyl)phenyl]ethyl]hydrazine |
| SMILES | NNC(Cc1ccncc1Cl)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C14H13ClF3N3/c15-12-8-20-6-5-9(12)7-13(21-19)10-3-1-2-4-11(10)14(16,17)18/h1-6,8,13,21H,7,19H2 |
| InChIKey | QWVCZHIFHXUYCW-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.73 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|