C9H15N5 — CID 102805925
2-cyclopropyl-1-(1,3-dimethylpyrazol-4-yl)guanidine (PubChem CID 102805925) has the molecular formula C9H15N5 and a molecular weight of 193.25 g/mol. Its IUPAC name is 2-cyclopropyl-1-(1,3-dimethylpyrazol-4-yl)guanidine.
| Compound Name | 2-cyclopropyl-1-(1,3-dimethylpyrazol-4-yl)guanidine |
|---|---|
| PubChem CID | 102805925 |
| Molecular Formula | C9H15N5 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | 2-cyclopropyl-1-(1,3-dimethylpyrazol-4-yl)guanidine |
| SMILES | Cc1nn(C)cc1N/C(N)=N/C1CC1 |
| InChI | InChI=1S/C9H15N5/c1-6-8(5-14(2)13-6)12-9(10)11-7-3-4-7/h5,7H,3-4H2,1-2H3,(H3,10,11,12) |
| InChIKey | ZVKRSBWOCNWDMM-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|